About 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine
2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine (PubChem CID 134305020) has the molecular formula C11H11BrN4O2
and a molecular weight of 311.14 g/mol. Its IUPAC name is 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine.
Molecular Properties
| Compound Name | 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine |
| PubChem CID | 134305020 |
| Molecular Formula | C11H11BrN4O2 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine |
| SMILES | Nc1ccnn1-c1ccc(Br)c(C2OCCO2)n1 |
| InChI | InChI=1S/C11H11BrN4O2/c12-7-1-2-9(16-8(13)3-4-14-16)15-10(7)11-17-5-6-18-11/h1-4,11H,5-6,13H2 |
| InChIKey | VECJOEVCHVJHAQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine?
The IUPAC name of 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine (CID 134305020) is 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine.
What is the SMILES notation for 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine?
The canonical SMILES for 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine is Nc1ccnn1-c1ccc(Br)c(C2OCCO2)n1.
What is the InChIKey of 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine?
The InChIKey is VECJOEVCHVJHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN4O2/c12-7-1-2-9(16-8(13)3-4-14-16)15-10(7)11-17-5-6-18-11/h1-4,11H,5-6,13H2.
What are the key properties of 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine?
2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine has a molecular weight of 311.14 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-bromo-6-(1,3-dioxolan-2-yl)-2-pyridinyl]pyrazol-3-amine is sourced from PubChem (CID 134305020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).