C22H26N2O3 — CID 134305233
1,6-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-phenylcyclohexa-2,4-dien-1-ol (PubChem CID 134305233) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1,6-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-phenylcyclohexa-2,4-dien-1-ol.
| Compound Name | 1,6-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-phenylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 134305233 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1,6-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-phenylcyclohexa-2,4-dien-1-ol |
| SMILES | CC1(C)COC(C2C=C(c3ccccc3)C=CC2(O)C2=NC(C)(C)CO2)=N1 |
| InChI | InChI=1S/C22H26N2O3/c1-20(2)13-26-18(23-20)17-12-16(15-8-6-5-7-9-15)10-11-22(17,25)19-24-21(3,4)14-27-19/h5-12,17,25H,13-14H2,1-4H3 |
| InChIKey | WMQOQNVVBYHHOL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |