C30H22FN5O2 — CID 134305911
5-[(6-fluoro-2-pyridinyl)amino]-6-(4-methoxyphenyl)-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 134305911) has the molecular formula C30H22FN5O2 and a molecular weight of 503.54 g/mol. Its IUPAC name is 5-[(6-fluoro-2-pyridinyl)amino]-6-(4-methoxyphenyl)-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-[(6-fluoro-2-pyridinyl)amino]-6-(4-methoxyphenyl)-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 134305911 |
| Molecular Formula | C30H22FN5O2 |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 5-[(6-fluoro-2-pyridinyl)amino]-6-(4-methoxyphenyl)-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | COc1ccc(-c2c(Nc3cccc(F)n3)nc3c(-c4ccccc4)c(-c4ccccc4)[nH]n3c2=O)cc1 |
| InChI | InChI=1S/C30H22FN5O2/c1-38-22-17-15-20(16-18-22)26-28(33-24-14-8-13-23(31)32-24)34-29-25(19-9-4-2-5-10-19)27(35-36(29)30(26)37)21-11-6-3-7-12-21/h2-18,35H,1H3,(H,32,33) |
| InChIKey | MSNWODXJVWZBFT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|