About 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one
5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one (PubChem CID 134305994) has the molecular formula C15H21N3O3
and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one |
| PubChem CID | 134305994 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one |
| SMILES | COCC(COC)n1ccnc1-c1cc(C)c(=O)n(C)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-11-7-12(8-17(2)15(11)19)14-16-5-6-18(14)13(9-20-3)10-21-4/h5-8,13H,9-10H2,1-4H3 |
| InChIKey | ZYEVNVBNADIMLN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one?
The IUPAC name of 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one (CID 134305994) is 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one.
What is the SMILES notation for 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one?
The canonical SMILES for 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one is COCC(COC)n1ccnc1-c1cc(C)c(=O)n(C)c1.
What is the InChIKey of 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one?
The InChIKey is ZYEVNVBNADIMLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O3/c1-11-7-12(8-17(2)15(11)19)14-16-5-6-18(14)13(9-20-3)10-21-4/h5-8,13H,9-10H2,1-4H3.
What are the key properties of 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one?
5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one has a molecular weight of 291.35 g/mol, XLogP of 1.39, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(1,3-dimethoxypropan-2-yl)imidazol-2-yl]-1,3-dimethylpyridin-2-one is sourced from PubChem (CID 134305994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).