About 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one
5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one (PubChem CID 134306034) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one |
| PubChem CID | 134306034 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one |
| SMILES | Cc1cc(-c2ncc[nH]2)cn(C)c1=O |
| InChI | InChI=1S/C10H11N3O/c1-7-5-8(6-13(2)10(7)14)9-11-3-4-12-9/h3-6H,1-2H3,(H,11,12) |
| InChIKey | AUCQGHRRPRBJDE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one?
The IUPAC name of 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one (CID 134306034) is 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one.
What is the SMILES notation for 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one?
The canonical SMILES for 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one is Cc1cc(-c2ncc[nH]2)cn(C)c1=O.
What is the InChIKey of 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one?
The InChIKey is AUCQGHRRPRBJDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-7-5-8(6-13(2)10(7)14)9-11-3-4-12-9/h3-6H,1-2H3,(H,11,12).
What are the key properties of 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one?
5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one has a molecular weight of 189.22 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-imidazol-2-yl)-1,3-dimethylpyridin-2-one is sourced from PubChem (CID 134306034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).