About N,N-bis(3-aminopropyl)octanamide;dihydrochloride
N,N-bis(3-aminopropyl)octanamide;dihydrochloride (PubChem CID 134306237) has the molecular formula C14H33Cl2N3O
and a molecular weight of 330.34 g/mol. Its IUPAC name is N,N-bis(3-aminopropyl)octanamide;dihydrochloride.
Molecular Properties
| Compound Name | N,N-bis(3-aminopropyl)octanamide;dihydrochloride |
| PubChem CID | 134306237 |
| Molecular Formula | C14H33Cl2N3O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N,N-bis(3-aminopropyl)octanamide;dihydrochloride |
| SMILES | CCCCCCCC(=O)N(CCCN)CCCN.Cl.Cl |
| InChI | InChI=1S/C14H31N3O.2ClH/c1-2-3-4-5-6-9-14(18)17(12-7-10-15)13-8-11-16;;/h2-13,15-16H2,1H3;2*1H |
| InChIKey | ZLQPXYPRRIDRBD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(3-aminopropyl)octanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(3-aminopropyl)octanamide;dihydrochloride?
The IUPAC name of N,N-bis(3-aminopropyl)octanamide;dihydrochloride (CID 134306237) is N,N-bis(3-aminopropyl)octanamide;dihydrochloride.
What is the SMILES notation for N,N-bis(3-aminopropyl)octanamide;dihydrochloride?
The canonical SMILES for N,N-bis(3-aminopropyl)octanamide;dihydrochloride is CCCCCCCC(=O)N(CCCN)CCCN.Cl.Cl.
What is the InChIKey of N,N-bis(3-aminopropyl)octanamide;dihydrochloride?
The InChIKey is ZLQPXYPRRIDRBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N3O.2ClH/c1-2-3-4-5-6-9-14(18)17(12-7-10-15)13-8-11-16;;/h2-13,15-16H2,1H3;2*1H.
What are the key properties of N,N-bis(3-aminopropyl)octanamide;dihydrochloride?
N,N-bis(3-aminopropyl)octanamide;dihydrochloride has a molecular weight of 330.34 g/mol, XLogP of 2.72, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(3-aminopropyl)octanamide;dihydrochloride is sourced from PubChem (CID 134306237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).