C16H12ClFN4O2S — CID 134306438
6-amino-N-[5-chloro-6-(2-fluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide (PubChem CID 134306438) has the molecular formula C16H12ClFN4O2S and a molecular weight of 378.82 g/mol. Its IUPAC name is 6-amino-N-[5-chloro-6-(2-fluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide.
| Compound Name | 6-amino-N-[5-chloro-6-(2-fluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134306438 |
| Molecular Formula | C16H12ClFN4O2S |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 6-amino-N-[5-chloro-6-(2-fluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide |
| SMILES | Nc1cccc(S(=O)(=O)Nc2ccc(Cl)c(-c3ccccc3F)n2)n1 |
| InChI | InChI=1S/C16H12ClFN4O2S/c17-11-8-9-14(21-16(11)10-4-1-2-5-12(10)18)22-25(23,24)15-7-3-6-13(19)20-15/h1-9H,(H2,19,20)(H,21,22) |
| InChIKey | PPXNBBFSTUJJMT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |