About 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide
6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide (PubChem CID 134306449) has the molecular formula C16H10ClF3N4O2S
and a molecular weight of 414.80 g/mol. Its IUPAC name is 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide.
Molecular Properties
| Compound Name | 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide |
| PubChem CID | 134306449 |
| Molecular Formula | C16H10ClF3N4O2S |
| Molecular Weight | 414.80 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide |
| SMILES | Nc1cccc(S(=O)(=O)Nc2ccc(Cl)c(-c3c(F)ccc(F)c3F)n2)n1 |
| InChI | InChI=1S/C16H10ClF3N4O2S/c17-8-4-7-12(24-27(25,26)13-3-1-2-11(21)22-13)23-16(8)14-9(18)5-6-10(19)15(14)20/h1-7H,(H2,21,22)(H,23,24) |
| InChIKey | ARBUZRKMAMNMBQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide?
The IUPAC name of 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide (CID 134306449) is 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide.
What is the SMILES notation for 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide?
The canonical SMILES for 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide is Nc1cccc(S(=O)(=O)Nc2ccc(Cl)c(-c3c(F)ccc(F)c3F)n2)n1.
What is the InChIKey of 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide?
The InChIKey is ARBUZRKMAMNMBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClF3N4O2S/c17-8-4-7-12(24-27(25,26)13-3-1-2-11(21)22-13)23-16(8)14-9(18)5-6-10(19)15(14)20/h1-7H,(H2,21,22)(H,23,24).
What are the key properties of 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide?
6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide has a molecular weight of 414.80 g/mol, XLogP of 3.60, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-[5-chloro-6-(2,3,6-trifluorophenyl)-2-pyridinyl]pyridine-2-sulfonamide is sourced from PubChem (CID 134306449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).