C17H12ClF3N4O2S — CID 134306571
6-amino-N-[6-(2-chlorophenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide (PubChem CID 134306571) has the molecular formula C17H12ClF3N4O2S and a molecular weight of 428.82 g/mol. Its IUPAC name is 6-amino-N-[6-(2-chlorophenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide.
| Compound Name | 6-amino-N-[6-(2-chlorophenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134306571 |
| Molecular Formula | C17H12ClF3N4O2S |
| Molecular Weight | 428.82 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 6-amino-N-[6-(2-chlorophenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide |
| SMILES | Nc1cccc(S(=O)(=O)Nc2ccc(C(F)(F)F)c(-c3ccccc3Cl)n2)n1 |
| InChI | InChI=1S/C17H12ClF3N4O2S/c18-12-5-2-1-4-10(12)16-11(17(19,20)21)8-9-14(24-16)25-28(26,27)15-7-3-6-13(22)23-15/h1-9H,(H2,22,23)(H,24,25) |
| InChIKey | PAIAKNUERDAQLN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |