C10H7FO4 — CID 134306760
4-fluorobicyclo[4.2.0]octa-1(6),2,4-triene-7,7-dicarboxylic acid (PubChem CID 134306760) has the molecular formula C10H7FO4 and a molecular weight of 210.16 g/mol. Its IUPAC name is 4-fluorobicyclo[4.2.0]octa-1(6),2,4-triene-7,7-dicarboxylic acid.
| Compound Name | 4-fluorobicyclo[4.2.0]octa-1(6),2,4-triene-7,7-dicarboxylic acid |
|---|---|
| PubChem CID | 134306760 |
| Molecular Formula | C10H7FO4 |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 4-fluorobicyclo[4.2.0]octa-1(6),2,4-triene-7,7-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)Cc2ccc(F)cc21 |
| InChI | InChI=1S/C10H7FO4/c11-6-2-1-5-4-10(8(12)13,9(14)15)7(5)3-6/h1-3H,4H2,(H,12,13)(H,14,15) |
| InChIKey | UOQATHZNMFACDJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|