About 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide
6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide (PubChem CID 134306927) has the molecular formula C18H16ClFN4O2S
and a molecular weight of 406.87 g/mol. Its IUPAC name is 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide.
Molecular Properties
| Compound Name | 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide |
| PubChem CID | 134306927 |
| Molecular Formula | C18H16ClFN4O2S |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide |
| SMILES | Cc1cccc(C)c1-c1nc(NS(=O)(=O)c2cccc(N)n2)c(F)cc1Cl |
| InChI | InChI=1S/C18H16ClFN4O2S/c1-10-5-3-6-11(2)16(10)17-12(19)9-13(20)18(23-17)24-27(25,26)15-8-4-7-14(21)22-15/h3-9H,1-2H3,(H2,21,22)(H,23,24) |
| InChIKey | NUQBBZHVHHXTJW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide?
The IUPAC name of 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide (CID 134306927) is 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide.
What is the SMILES notation for 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide?
The canonical SMILES for 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide is Cc1cccc(C)c1-c1nc(NS(=O)(=O)c2cccc(N)n2)c(F)cc1Cl.
What is the InChIKey of 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide?
The InChIKey is NUQBBZHVHHXTJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClFN4O2S/c1-10-5-3-6-11(2)16(10)17-12(19)9-13(20)18(23-17)24-27(25,26)15-8-4-7-14(21)22-15/h3-9H,1-2H3,(H2,21,22)(H,23,24).
What are the key properties of 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide?
6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide has a molecular weight of 406.87 g/mol, XLogP of 3.94, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-[5-chloro-6-(2,6-dimethylphenyl)-3-fluoro-2-pyridinyl]pyridine-2-sulfonamide is sourced from PubChem (CID 134306927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).