C18H13N3O — CID 134307194
2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 134307194) has the molecular formula C18H13N3O and a molecular weight of 287.32 g/mol. Its IUPAC name is 2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 134307194 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1ccnc2c(-c3ccccc3)c(-c3ccccc3)[nH]n12 |
| InChI | InChI=1S/C18H13N3O/c22-15-11-12-19-18-16(13-7-3-1-4-8-13)17(20-21(15)18)14-9-5-2-6-10-14/h1-12,20H |
| InChIKey | RJZCZETXTGBVEV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |