C23H27F5O — CID 13430724
2,3,4-tritert-butyl-5-(2,3,4,5,6-pentafluorophenyl)cyclopenta-2,4-dien-1-one (PubChem CID 13430724) has the molecular formula C23H27F5O and a molecular weight of 414.46 g/mol. Its IUPAC name is 2,3,4-tritert-butyl-5-(2,3,4,5,6-pentafluorophenyl)cyclopenta-2,4-dien-1-one.
| Compound Name | 2,3,4-tritert-butyl-5-(2,3,4,5,6-pentafluorophenyl)cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 13430724 |
| Molecular Formula | C23H27F5O |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2,3,4-tritert-butyl-5-(2,3,4,5,6-pentafluorophenyl)cyclopenta-2,4-dien-1-one |
| SMILES | CC(C)(C)C1=C(c2c(F)c(F)c(F)c(F)c2F)C(=O)C(C(C)(C)C)=C1C(C)(C)C |
| InChI | InChI=1S/C23H27F5O/c1-21(2,3)12-10(11-15(24)17(26)19(28)18(27)16(11)25)20(29)14(23(7,8)9)13(12)22(4,5)6/h1-9H3 |
| InChIKey | RJLOCOSPJGEOAW-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|