About 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one
6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 134307590) has the molecular formula C25H17BrN4O3
and a molecular weight of 501.34 g/mol. Its IUPAC name is 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 134307590 |
| Molecular Formula | C25H17BrN4O3 |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1nc2c(-c3ccccc3)c(-c3ccccc3)[nH]n2c(=O)c1-c1ccc([N+](=O)[O-])c(Br)c1 |
| InChI | InChI=1S/C25H17BrN4O3/c1-15-21(18-12-13-20(30(32)33)19(26)14-18)25(31)29-24(27-15)22(16-8-4-2-5-9-16)23(28-29)17-10-6-3-7-11-17/h2-14,28H,1H3 |
| InChIKey | MXPYISOQGMSUED-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 134307590) is 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is Cc1nc2c(-c3ccccc3)c(-c3ccccc3)[nH]n2c(=O)c1-c1ccc([N+](=O)[O-])c(Br)c1.
What is the InChIKey of 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is MXPYISOQGMSUED-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17BrN4O3/c1-15-21(18-12-13-20(30(32)33)19(26)14-18)25(31)29-24(27-15)22(16-8-4-2-5-9-16)23(28-29)17-10-6-3-7-11-17/h2-14,28H,1H3.
What are the key properties of 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 501.34 g/mol, XLogP of 6.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-bromo-4-nitrophenyl)-5-methyl-2,3-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 134307590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).