C9H17N3 — CID 134307665
(3S,4R,5S)-4-azido-3,5-dimethylhept-1-ene (PubChem CID 134307665) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (3S,4R,5S)-4-azido-3,5-dimethylhept-1-ene.
| Compound Name | (3S,4R,5S)-4-azido-3,5-dimethylhept-1-ene |
|---|---|
| PubChem CID | 134307665 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (3S,4R,5S)-4-azido-3,5-dimethylhept-1-ene |
| SMILES | C=C[C@H](C)[C@H](N=[N+]=[N-])[C@@H](C)CC |
| InChI | InChI=1S/C9H17N3/c1-5-7(3)9(11-12-10)8(4)6-2/h5,7-9H,1,6H2,2-4H3/t7-,8-,9-/m0/s1 |
| InChIKey | SMOMQMZPOUZBAF-CIUDSAMLSA-N |
| XLogP | 3.53 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|