C24H22N4O2S — CID 134307943
3-(2H-pyran-4-yl)-4-[[4-(1,3-thiazol-4-yl)phenyl]methyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxamide (PubChem CID 134307943) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-(2H-pyran-4-yl)-4-[[4-(1,3-thiazol-4-yl)phenyl]methyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxamide.
| Compound Name | 3-(2H-pyran-4-yl)-4-[[4-(1,3-thiazol-4-yl)phenyl]methyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 134307943 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3-(2H-pyran-4-yl)-4-[[4-(1,3-thiazol-4-yl)phenyl]methyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxamide |
| SMILES | NC(=O)c1nc2c(c(Cc3ccc(-c4cscn4)cc3)c1C1=CCOC=C1)CCNC2 |
| InChI | InChI=1S/C24H22N4O2S/c25-24(29)23-22(17-6-9-30-10-7-17)19(18-5-8-26-12-20(18)28-23)11-15-1-3-16(4-2-15)21-13-31-14-27-21/h1-4,6-7,9,13-14,26H,5,8,10-12H2,(H2,25,29) |
| InChIKey | YHXHCOCJLQAWJA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |