C31H26N6O2 — CID 134307962
N-(3-cyclohex-3-en-1-yl-7-methoxy-2-phenyl-6-quinolin-6-ylpyrazolo[1,5-a]pyrimidin-5-yl)-1,2-oxazol-3-amine (PubChem CID 134307962) has the molecular formula C31H26N6O2 and a molecular weight of 514.59 g/mol. Its IUPAC name is N-(3-cyclohex-3-en-1-yl-7-methoxy-2-phenyl-6-quinolin-6-ylpyrazolo[1,5-a]pyrimidin-5-yl)-1,2-oxazol-3-amine.
| Compound Name | N-(3-cyclohex-3-en-1-yl-7-methoxy-2-phenyl-6-quinolin-6-ylpyrazolo[1,5-a]pyrimidin-5-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 134307962 |
| Molecular Formula | C31H26N6O2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | N-(3-cyclohex-3-en-1-yl-7-methoxy-2-phenyl-6-quinolin-6-ylpyrazolo[1,5-a]pyrimidin-5-yl)-1,2-oxazol-3-amine |
| SMILES | COc1c(-c2ccc3ncccc3c2)c(Nc2ccon2)nc2c(C3CC=CCC3)c(-c3ccccc3)nn12 |
| InChI | InChI=1S/C31H26N6O2/c1-38-31-27(23-14-15-24-22(19-23)13-8-17-32-24)29(33-25-16-18-39-36-25)34-30-26(20-9-4-2-5-10-20)28(35-37(30)31)21-11-6-3-7-12-21/h2-4,6-8,11-20H,5,9-10H2,1H3,(H,33,34,36) |
| InChIKey | WCKQWXQAWGYDNM-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|