About 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one
6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 134308263) has the molecular formula C24H25N5O
and a molecular weight of 399.50 g/mol. Its IUPAC name is 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 134308263 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1nc2c(N3CCCCC3)c(-c3ccccc3)[nH]n2c(=O)c1-c1ccc(N)cc1 |
| InChI | InChI=1S/C24H25N5O/c1-16-20(17-10-12-19(25)13-11-17)24(30)29-23(26-16)22(28-14-6-3-7-15-28)21(27-29)18-8-4-2-5-9-18/h2,4-5,8-13,27H,3,6-7,14-15,25H2,1H3 |
| InChIKey | DEFWPQGNJGFOKR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 134308263) is 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one is Cc1nc2c(N3CCCCC3)c(-c3ccccc3)[nH]n2c(=O)c1-c1ccc(N)cc1.
What is the InChIKey of 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is DEFWPQGNJGFOKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N5O/c1-16-20(17-10-12-19(25)13-11-17)24(30)29-23(26-16)22(28-14-6-3-7-15-28)21(27-29)18-8-4-2-5-9-18/h2,4-5,8-13,27H,3,6-7,14-15,25H2,1H3.
What are the key properties of 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 399.50 g/mol, XLogP of 4.24, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-aminophenyl)-5-methyl-2-phenyl-3-piperidin-1-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 134308263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).