About (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate
(2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate (PubChem CID 134308868) has the molecular formula C9H6N2O7
and a molecular weight of 254.15 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate |
| PubChem CID | 134308868 |
| Molecular Formula | C9H6N2O7 |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate |
| SMILES | O=C(ON1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H6N2O7/c12-5-1-2-6(13)10(5)17-9(16)18-11-7(14)3-4-8(11)15/h1-2H,3-4H2 |
| InChIKey | XYQRRWNWGWVOFY-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate (CID 134308868) is (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate is O=C(ON1C(=O)C=CC1=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate?
The InChIKey is XYQRRWNWGWVOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O7/c12-5-1-2-6(13)10(5)17-9(16)18-11-7(14)3-4-8(11)15/h1-2H,3-4H2.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate?
(2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate has a molecular weight of 254.15 g/mol, XLogP of -0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) (2,5-dioxopyrrol-1-yl) carbonate is sourced from PubChem (CID 134308868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).