C27H24N4O3 — CID 134309498
8-(1,3-dimethylcyclobutyl)-3-(furan-2-yl)-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine (PubChem CID 134309498) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is 8-(1,3-dimethylcyclobutyl)-3-(furan-2-yl)-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine.
| Compound Name | 8-(1,3-dimethylcyclobutyl)-3-(furan-2-yl)-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 134309498 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 8-(1,3-dimethylcyclobutyl)-3-(furan-2-yl)-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine |
| SMILES | CC1CC(C)(c2ccc3c(c2)C(c2ccccc2[N+](=O)[O-])=NCc2c(-c4ccco4)ncn2-3)C1 |
| InChI | InChI=1S/C27H24N4O3/c1-17-13-27(2,14-17)18-9-10-21-20(12-18)25(19-6-3-4-7-22(19)31(32)33)28-15-23-26(29-16-30(21)23)24-8-5-11-34-24/h3-12,16-17H,13-15H2,1-2H3 |
| InChIKey | RNHATRPMIYIWLR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 86.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|