C28H26N4O3 — CID 134309512
(4R)-8-(1,3-dimethylcyclobutyl)-3-(furan-2-yl)-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine (PubChem CID 134309512) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is (4R)-8-(1,3-dimethylcyclobutyl)-3-(furan-2-yl)-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine.
| Compound Name | (4R)-8-(1,3-dimethylcyclobutyl)-3-(furan-2-yl)-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 134309512 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (4R)-8-(1,3-dimethylcyclobutyl)-3-(furan-2-yl)-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine |
| SMILES | CC1CC(C)(c2ccc3c(c2)C(c2ccccc2[N+](=O)[O-])=N[C@H](C)c2c(-c4ccco4)ncn2-3)C1 |
| InChI | InChI=1S/C28H26N4O3/c1-17-14-28(3,15-17)19-10-11-22-21(13-19)25(20-7-4-5-8-23(20)32(33)34)30-18(2)27-26(29-16-31(22)27)24-9-6-12-35-24/h4-13,16-18H,14-15H2,1-3H3/t17?,18-,28?/m1/s1 |
| InChIKey | YBNLKZMLRRXIDX-GUGCMKBXSA-N |
| XLogP | 6.64 |
| TPSA | 86.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|