C34H28O4 — CID 134309891
3-ethynyl-4-[[3-[3-[(2-ethynyl-4-methoxyphenoxy)methyl]-2-methylphenyl]-2-methylphenyl]methoxy]benzaldehyde (PubChem CID 134309891) has the molecular formula C34H28O4 and a molecular weight of 500.59 g/mol. Its IUPAC name is 3-ethynyl-4-[[3-[3-[(2-ethynyl-4-methoxyphenoxy)methyl]-2-methylphenyl]-2-methylphenyl]methoxy]benzaldehyde.
| Compound Name | 3-ethynyl-4-[[3-[3-[(2-ethynyl-4-methoxyphenoxy)methyl]-2-methylphenyl]-2-methylphenyl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 134309891 |
| Molecular Formula | C34H28O4 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 3-ethynyl-4-[[3-[3-[(2-ethynyl-4-methoxyphenoxy)methyl]-2-methylphenyl]-2-methylphenyl]methoxy]benzaldehyde |
| SMILES | C#Cc1cc(C=O)ccc1OCc1cccc(-c2cccc(COc3ccc(OC)cc3C#C)c2C)c1C |
| InChI | InChI=1S/C34H28O4/c1-6-26-18-25(20-35)14-16-33(26)37-21-28-10-8-12-31(23(28)3)32-13-9-11-29(24(32)4)22-38-34-17-15-30(36-5)19-27(34)7-2/h1-2,8-20H,21-22H2,3-5H3 |
| InChIKey | BDUBYWMDQDHSNF-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|