About (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone
(2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone (PubChem CID 134309927) has the molecular formula C15H21NOS
and a molecular weight of 263.41 g/mol. Its IUPAC name is (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone.
Molecular Properties
| Compound Name | (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone |
| PubChem CID | 134309927 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone |
| SMILES | O=C(c1csc(C2CCCCC2)n1)C1CCCC1 |
| InChI | InChI=1S/C15H21NOS/c17-14(11-6-4-5-7-11)13-10-18-15(16-13)12-8-2-1-3-9-12/h10-12H,1-9H2 |
| InChIKey | OTGLTQMKWCIENO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone?
The IUPAC name of (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone (CID 134309927) is (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone.
What is the SMILES notation for (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone?
The canonical SMILES for (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone is O=C(c1csc(C2CCCCC2)n1)C1CCCC1.
What is the InChIKey of (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone?
The InChIKey is OTGLTQMKWCIENO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NOS/c17-14(11-6-4-5-7-11)13-10-18-15(16-13)12-8-2-1-3-9-12/h10-12H,1-9H2.
What are the key properties of (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone?
(2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone has a molecular weight of 263.41 g/mol, XLogP of 4.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclohexyl-1,3-thiazol-4-yl)-cyclopentylmethanone is sourced from PubChem (CID 134309927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).