About methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate
methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate (PubChem CID 134309972) has the molecular formula C17H16O4
and a molecular weight of 284.31 g/mol. Its IUPAC name is methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate.
Molecular Properties
| Compound Name | methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate |
| PubChem CID | 134309972 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate |
| SMILES | C#CC(O)C#CCC(C)(CC#Cc1ccoc1)C(=O)OC |
| InChI | InChI=1S/C17H16O4/c1-4-15(18)8-6-11-17(2,16(19)20-3)10-5-7-14-9-12-21-13-14/h1,9,12-13,15,18H,10-11H2,2-3H3 |
| InChIKey | OUEFCROKFBFUAV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate?
The IUPAC name of methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate (CID 134309972) is methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate.
What is the SMILES notation for methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate?
The canonical SMILES for methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate is C#CC(O)C#CCC(C)(CC#Cc1ccoc1)C(=O)OC.
What is the InChIKey of methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate?
The InChIKey is OUEFCROKFBFUAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O4/c1-4-15(18)8-6-11-17(2,16(19)20-3)10-5-7-14-9-12-21-13-14/h1,9,12-13,15,18H,10-11H2,2-3H3.
What are the key properties of methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate?
methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate has a molecular weight of 284.31 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(furan-3-yl)prop-2-ynyl]-6-hydroxy-2-methylocta-4,7-diynoate is sourced from PubChem (CID 134309972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).