C31H38N2O2 — CID 134310015
ethyl (E)-4-[(2E)-2-[(E)-3-(1-ethyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]but-2-enoate (PubChem CID 134310015) has the molecular formula C31H38N2O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is ethyl (E)-4-[(2E)-2-[(E)-3-(1-ethyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]but-2-enoate.
| Compound Name | ethyl (E)-4-[(2E)-2-[(E)-3-(1-ethyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 134310015 |
| Molecular Formula | C31H38N2O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | ethyl (E)-4-[(2E)-2-[(E)-3-(1-ethyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN1/C(=C/C=C/C2N(CC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H38N2O2/c1-7-32-25-17-11-9-15-23(25)30(3,4)27(32)19-13-20-28-31(5,6)24-16-10-12-18-26(24)33(28)22-14-21-29(34)35-8-2/h9-21,27H,7-8,22H2,1-6H3/b19-13+,21-14+,28-20+ |
| InChIKey | OUYNBLOONUCZTK-LIAVOMEESA-N |
| XLogP | 6.53 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|