C22H14O4 — CID 134310055
5,11-dihydroxy-15-(4-methylphenyl)-14-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one (PubChem CID 134310055) has the molecular formula C22H14O4 and a molecular weight of 342.35 g/mol. Its IUPAC name is 5,11-dihydroxy-15-(4-methylphenyl)-14-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one.
| Compound Name | 5,11-dihydroxy-15-(4-methylphenyl)-14-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one |
|---|---|
| PubChem CID | 134310055 |
| Molecular Formula | C22H14O4 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 5,11-dihydroxy-15-(4-methylphenyl)-14-oxatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one |
| SMILES | Cc1ccc(-c2oc3cc(O)cc4c3c2-c2ccc(O)cc2C4=O)cc1 |
| InChI | InChI=1S/C22H14O4/c1-11-2-4-12(5-3-11)22-20-15-7-6-13(23)8-16(15)21(25)17-9-14(24)10-18(26-22)19(17)20/h2-10,23-24H,1H3 |
| InChIKey | HKHBKKSDYOYRFN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |