C10H21N3 — CID 134310081
(3E)-2-N,4-N-dimethyl-4-N-[2-(methylamino)ethyl]penta-1,3-diene-2,4-diamine (PubChem CID 134310081) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is (3E)-2-N,4-N-dimethyl-4-N-[2-(methylamino)ethyl]penta-1,3-diene-2,4-diamine.
| Compound Name | (3E)-2-N,4-N-dimethyl-4-N-[2-(methylamino)ethyl]penta-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 134310081 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | (3E)-2-N,4-N-dimethyl-4-N-[2-(methylamino)ethyl]penta-1,3-diene-2,4-diamine |
| SMILES | C=C(/C=C(\C)N(C)CCNC)NC |
| InChI | InChI=1S/C10H21N3/c1-9(12-4)8-10(2)13(5)7-6-11-3/h8,11-12H,1,6-7H2,2-5H3/b10-8+ |
| InChIKey | JSKKBQVZCFLTAQ-CSKARUKUSA-N |
| XLogP | 0.77 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|