C13H16N4O5S2 — CID 134310311
methyl 2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]acetate (PubChem CID 134310311) has the molecular formula C13H16N4O5S2 and a molecular weight of 372.43 g/mol. Its IUPAC name is methyl 2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]acetate.
| Compound Name | methyl 2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]acetate |
|---|---|
| PubChem CID | 134310311 |
| Molecular Formula | C13H16N4O5S2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | methyl 2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]acetate |
| SMILES | COC(=O)C[C@@H]1S[C@@H](CO)O[C@H]1n1c(=O)sc2c(C)nc(N)nc21 |
| InChI | InChI=1S/C13H16N4O5S2/c1-5-9-10(16-12(14)15-5)17(13(20)24-9)11-6(3-7(19)21-2)23-8(4-18)22-11/h6,8,11,18H,3-4H2,1-2H3,(H2,14,15,16)/t6-,8-,11+/m0/s1 |
| InChIKey | DADIVBBBTZMVJN-GEOGLEFRSA-N |
| XLogP | 0.26 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |