C12H14N4O5S2 — CID 134310313
2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]acetic acid (PubChem CID 134310313) has the molecular formula C12H14N4O5S2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]acetic acid.
| Compound Name | 2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 134310313 |
| Molecular Formula | C12H14N4O5S2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-[(2S,4S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]acetic acid |
| SMILES | Cc1nc(N)nc2c1sc(=O)n2[C@@H]1O[C@H](CO)S[C@H]1CC(=O)O |
| InChI | InChI=1S/C12H14N4O5S2/c1-4-8-9(15-11(13)14-4)16(12(20)23-8)10-5(2-6(18)19)22-7(3-17)21-10/h5,7,10,17H,2-3H2,1H3,(H,18,19)(H2,13,14,15)/t5-,7-,10+/m0/s1 |
| InChIKey | XFFQCEDYUCSLIZ-YCRQMBEESA-N |
| XLogP | 0.17 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |