C14H17NO2S — CID 134310392
10-propan-2-yl-3,4-dihydro-1H-[1,4]thiazino[4,3-a]indole 2,2-dioxide (PubChem CID 134310392) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 10-propan-2-yl-3,4-dihydro-1H-[1,4]thiazino[4,3-a]indole 2,2-dioxide.
| Compound Name | 10-propan-2-yl-3,4-dihydro-1H-[1,4]thiazino[4,3-a]indole 2,2-dioxide |
|---|---|
| PubChem CID | 134310392 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 10-propan-2-yl-3,4-dihydro-1H-[1,4]thiazino[4,3-a]indole 2,2-dioxide |
| SMILES | CC(C)c1c2n(c3ccccc13)CCS(=O)(=O)C2 |
| InChI | InChI=1S/C14H17NO2S/c1-10(2)14-11-5-3-4-6-12(11)15-7-8-18(16,17)9-13(14)15/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | PAOSGSLFBRBWKM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|