C21H31N — CID 134310453
(2Z,4E,6Z)-N-(2-methylbutan-2-yl)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]octa-2,4,6-trien-4-amine (PubChem CID 134310453) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (2Z,4E,6Z)-N-(2-methylbutan-2-yl)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]octa-2,4,6-trien-4-amine.
| Compound Name | (2Z,4E,6Z)-N-(2-methylbutan-2-yl)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]octa-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 134310453 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (2Z,4E,6Z)-N-(2-methylbutan-2-yl)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]octa-2,4,6-trien-4-amine |
| SMILES | C=C/C=C\C(=C/C=C)N(C(/C=C\C)=C/C=C\C)C(C)(C)CC |
| InChI | InChI=1S/C21H31N/c1-8-13-17-19(15-10-3)22(21(6,7)12-5)20(16-11-4)18-14-9-2/h8-11,13-18H,1,3,12H2,2,4-7H3/b14-9-,16-11-,17-13-,19-15+,20-18+ |
| InChIKey | KYTLIXKBIXQVOV-HXCDAIJTSA-N |
| XLogP | 6.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|