C10H20N4O — CID 134310466
(3R,4S,6S)-6-(azidomethyl)-N,N,2,3-tetramethyloxan-4-amine (PubChem CID 134310466) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is (3R,4S,6S)-6-(azidomethyl)-N,N,2,3-tetramethyloxan-4-amine.
| Compound Name | (3R,4S,6S)-6-(azidomethyl)-N,N,2,3-tetramethyloxan-4-amine |
|---|---|
| PubChem CID | 134310466 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (3R,4S,6S)-6-(azidomethyl)-N,N,2,3-tetramethyloxan-4-amine |
| SMILES | CC1O[C@H](CN=[N+]=[N-])C[C@H](N(C)C)[C@H]1C |
| InChI | InChI=1S/C10H20N4O/c1-7-8(2)15-9(6-12-13-11)5-10(7)14(3)4/h7-10H,5-6H2,1-4H3/t7-,8?,9-,10-/m0/s1 |
| InChIKey | IHYFBDPZSZWVDA-HFXXUHSDSA-N |
| XLogP | 2.04 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|