About 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane
8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane (PubChem CID 134310711) has the molecular formula C12H12NP
and a molecular weight of 201.21 g/mol. Its IUPAC name is 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane.
Molecular Properties
| Compound Name | 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane |
| PubChem CID | 134310711 |
| Molecular Formula | C12H12NP |
| Molecular Weight | 201.21 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane |
| SMILES | [H]/P=C1\CCc2cc3ccccc3n2C1 |
| InChI | InChI=1S/C12H12NP/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-4,7,14H,5-6,8H2 |
| InChIKey | ZUJHXKNUYLCXGN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane?
The IUPAC name of 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane (CID 134310711) is 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane.
What is the SMILES notation for 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane?
The canonical SMILES for 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane is [H]/P=C1\CCc2cc3ccccc3n2C1.
What is the InChIKey of 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane?
The InChIKey is ZUJHXKNUYLCXGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12NP/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-4,7,14H,5-6,8H2.
What are the key properties of 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane?
8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane has a molecular weight of 201.21 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydro-6H-pyrido[1,2-a]indol-7-ylidenephosphane is sourced from PubChem (CID 134310711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).