About 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one
5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one (PubChem CID 134311302) has the molecular formula C19H12F5NO2S
and a molecular weight of 413.37 g/mol. Its IUPAC name is 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 134311302 |
| Molecular Formula | C19H12F5NO2S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one |
| SMILES | Cn1cc(-c2cc(S)ccc2Oc2ccc(F)cc2F)cc(C(F)(F)F)c1=O |
| InChI | InChI=1S/C19H12F5NO2S/c1-25-9-10(6-14(18(25)26)19(22,23)24)13-8-12(28)3-5-16(13)27-17-4-2-11(20)7-15(17)21/h2-9,28H,1H3 |
| InChIKey | RITWQBMKAPYOGP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 31.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one (CID 134311302) is 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one is Cn1cc(-c2cc(S)ccc2Oc2ccc(F)cc2F)cc(C(F)(F)F)c1=O.
What is the InChIKey of 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one?
The InChIKey is RITWQBMKAPYOGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F5NO2S/c1-25-9-10(6-14(18(25)26)19(22,23)24)13-8-12(28)3-5-16(13)27-17-4-2-11(20)7-15(17)21/h2-9,28H,1H3.
What are the key properties of 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one?
5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one has a molecular weight of 413.37 g/mol, XLogP of 5.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,4-difluorophenoxy)-5-sulfanylphenyl]-1-methyl-3-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 134311302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).