About 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine
3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine (PubChem CID 134312135) has the molecular formula C14H19N3
and a molecular weight of 229.33 g/mol. Its IUPAC name is 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine.
Molecular Properties
| Compound Name | 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine |
| PubChem CID | 134312135 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine |
| SMILES | CCCCC1=C(C)N=c2ccc(N)cc2=NC1 |
| InChI | InChI=1S/C14H19N3/c1-3-4-5-11-9-16-14-8-12(15)6-7-13(14)17-10(11)2/h6-8H,3-5,9,15H2,1-2H3 |
| InChIKey | PSDZXMRAFOXDQB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine?
The IUPAC name of 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine (CID 134312135) is 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine.
What is the SMILES notation for 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine?
The canonical SMILES for 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine is CCCCC1=C(C)N=c2ccc(N)cc2=NC1.
What is the InChIKey of 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine?
The InChIKey is PSDZXMRAFOXDQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3/c1-3-4-5-11-9-16-14-8-12(15)6-7-13(14)17-10(11)2/h6-8H,3-5,9,15H2,1-2H3.
What are the key properties of 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine?
3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine has a molecular weight of 229.33 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4-methyl-2H-1,5-benzodiazepin-8-amine is sourced from PubChem (CID 134312135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).