About (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine
(Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine (PubChem CID 134312170) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine.
Molecular Properties
| Compound Name | (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine |
| PubChem CID | 134312170 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine |
| SMILES | Cc1nc(C(C)(C)C)c(C)nc1/C=C\C(C)N |
| InChI | InChI=1S/C14H23N3/c1-9(15)7-8-12-10(2)17-13(11(3)16-12)14(4,5)6/h7-9H,15H2,1-6H3/b8-7- |
| InChIKey | GWJMQVXVPWJQIR-FPLPWBNLSA-N |
| XLogP | 2.75 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine?
The IUPAC name of (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine (CID 134312170) is (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine.
What is the SMILES notation for (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine?
The canonical SMILES for (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine is Cc1nc(C(C)(C)C)c(C)nc1/C=C\C(C)N.
What is the InChIKey of (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine?
The InChIKey is GWJMQVXVPWJQIR-FPLPWBNLSA-N. The full InChI is InChI=1S/C14H23N3/c1-9(15)7-8-12-10(2)17-13(11(3)16-12)14(4,5)6/h7-9H,15H2,1-6H3/b8-7-.
What are the key properties of (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine?
(Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine has a molecular weight of 233.36 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(5-tert-butyl-3,6-dimethylpyrazin-2-yl)but-3-en-2-amine is sourced from PubChem (CID 134312170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).