About 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine
4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine (PubChem CID 134312193) has the molecular formula C16H25N3
and a molecular weight of 259.40 g/mol. Its IUPAC name is 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine |
| PubChem CID | 134312193 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine |
| SMILES | C=N/C(CCCCCC)=C(C)\N=C1\C=CC(N)=CC1 |
| InChI | InChI=1S/C16H25N3/c1-4-5-6-7-8-16(18-3)13(2)19-15-11-9-14(17)10-12-15/h9-11H,3-8,12,17H2,1-2H3/b16-13-,19-15- |
| InChIKey | BMVCZXXDLYLUFF-BDLUJXIASA-N |
| XLogP | 4.13 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine?
The IUPAC name of 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine (CID 134312193) is 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine?
The canonical SMILES for 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine is C=N/C(CCCCCC)=C(C)\N=C1\C=CC(N)=CC1.
What is the InChIKey of 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine?
The InChIKey is BMVCZXXDLYLUFF-BDLUJXIASA-N. The full InChI is InChI=1S/C16H25N3/c1-4-5-6-7-8-16(18-3)13(2)19-15-11-9-14(17)10-12-15/h9-11H,3-8,12,17H2,1-2H3/b16-13-,19-15-.
What are the key properties of 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine?
4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine has a molecular weight of 259.40 g/mol, XLogP of 4.13, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-3-(methylideneamino)non-2-en-2-yl]iminocyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 134312193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).