About 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol
2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol (PubChem CID 134312349) has the molecular formula C23H14BrN3O2
and a molecular weight of 444.29 g/mol. Its IUPAC name is 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol.
Molecular Properties
| Compound Name | 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol |
| PubChem CID | 134312349 |
| Molecular Formula | C23H14BrN3O2 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol |
| SMILES | Oc1ccc2c3ccc(O)cc3c3[nH]c(-c4c[nH]c5ccc(Br)cc45)nc3c2c1 |
| InChI | InChI=1S/C23H14BrN3O2/c24-11-1-6-20-16(7-11)19(10-25-20)23-26-21-17-8-12(28)2-4-14(17)15-5-3-13(29)9-18(15)22(21)27-23/h1-10,25,28-29H,(H,26,27) |
| InChIKey | ZPFFQQHQQPNOTB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol?
The IUPAC name of 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol (CID 134312349) is 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol.
What is the SMILES notation for 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol?
The canonical SMILES for 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol is Oc1ccc2c3ccc(O)cc3c3[nH]c(-c4c[nH]c5ccc(Br)cc45)nc3c2c1.
What is the InChIKey of 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol?
The InChIKey is ZPFFQQHQQPNOTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14BrN3O2/c24-11-1-6-20-16(7-11)19(10-25-20)23-26-21-17-8-12(28)2-4-14(17)15-5-3-13(29)9-18(15)22(21)27-23/h1-10,25,28-29H,(H,26,27).
What are the key properties of 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol?
2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol has a molecular weight of 444.29 g/mol, XLogP of 6.19, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole-5,10-diol is sourced from PubChem (CID 134312349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).