About 2-heptan-4-yl-6-iodo-1,3-benzothiazole
2-heptan-4-yl-6-iodo-1,3-benzothiazole (PubChem CID 134313010) has the molecular formula C14H18INS
and a molecular weight of 359.28 g/mol. Its IUPAC name is 2-heptan-4-yl-6-iodo-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-heptan-4-yl-6-iodo-1,3-benzothiazole |
| PubChem CID | 134313010 |
| Molecular Formula | C14H18INS |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 2-heptan-4-yl-6-iodo-1,3-benzothiazole |
| SMILES | CCCC(CCC)c1nc2ccc(I)cc2s1 |
| InChI | InChI=1S/C14H18INS/c1-3-5-10(6-4-2)14-16-12-8-7-11(15)9-13(12)17-14/h7-10H,3-6H2,1-2H3 |
| InChIKey | VOCJWMNVAKOYLD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-heptan-4-yl-6-iodo-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptan-4-yl-6-iodo-1,3-benzothiazole?
The IUPAC name of 2-heptan-4-yl-6-iodo-1,3-benzothiazole (CID 134313010) is 2-heptan-4-yl-6-iodo-1,3-benzothiazole.
What is the SMILES notation for 2-heptan-4-yl-6-iodo-1,3-benzothiazole?
The canonical SMILES for 2-heptan-4-yl-6-iodo-1,3-benzothiazole is CCCC(CCC)c1nc2ccc(I)cc2s1.
What is the InChIKey of 2-heptan-4-yl-6-iodo-1,3-benzothiazole?
The InChIKey is VOCJWMNVAKOYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18INS/c1-3-5-10(6-4-2)14-16-12-8-7-11(15)9-13(12)17-14/h7-10H,3-6H2,1-2H3.
What are the key properties of 2-heptan-4-yl-6-iodo-1,3-benzothiazole?
2-heptan-4-yl-6-iodo-1,3-benzothiazole has a molecular weight of 359.28 g/mol, XLogP of 5.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptan-4-yl-6-iodo-1,3-benzothiazole is sourced from PubChem (CID 134313010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).