About 6-fluoro-4-methyl-5,6-dihydroquinazoline
6-fluoro-4-methyl-5,6-dihydroquinazoline (PubChem CID 134313088) has the molecular formula C9H9FN2
and a molecular weight of 164.18 g/mol. Its IUPAC name is 6-fluoro-4-methyl-5,6-dihydroquinazoline.
Molecular Properties
| Compound Name | 6-fluoro-4-methyl-5,6-dihydroquinazoline |
| PubChem CID | 134313088 |
| Molecular Formula | C9H9FN2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 6-fluoro-4-methyl-5,6-dihydroquinazoline |
| SMILES | Cc1ncnc2c1CC(F)C=C2 |
| InChI | InChI=1S/C9H9FN2/c1-6-8-4-7(10)2-3-9(8)12-5-11-6/h2-3,5,7H,4H2,1H3 |
| InChIKey | ZKALOWIASWNYCU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-4-methyl-5,6-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-4-methyl-5,6-dihydroquinazoline?
The IUPAC name of 6-fluoro-4-methyl-5,6-dihydroquinazoline (CID 134313088) is 6-fluoro-4-methyl-5,6-dihydroquinazoline.
What is the SMILES notation for 6-fluoro-4-methyl-5,6-dihydroquinazoline?
The canonical SMILES for 6-fluoro-4-methyl-5,6-dihydroquinazoline is Cc1ncnc2c1CC(F)C=C2.
What is the InChIKey of 6-fluoro-4-methyl-5,6-dihydroquinazoline?
The InChIKey is ZKALOWIASWNYCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2/c1-6-8-4-7(10)2-3-9(8)12-5-11-6/h2-3,5,7H,4H2,1H3.
What are the key properties of 6-fluoro-4-methyl-5,6-dihydroquinazoline?
6-fluoro-4-methyl-5,6-dihydroquinazoline has a molecular weight of 164.18 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-4-methyl-5,6-dihydroquinazoline is sourced from PubChem (CID 134313088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).