About (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine
(6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine (PubChem CID 134313135) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine |
| PubChem CID | 134313135 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine |
| SMILES | C=N/C(C)=C1/C=C(OC)C(OC)=C/C1=N\C |
| InChI | InChI=1S/C12H16N2O2/c1-8(13-2)9-6-11(15-4)12(16-5)7-10(9)14-3/h6-7H,2H2,1,3-5H3/b9-8-,14-10+ |
| InChIKey | FCWKGUSRUKRGBB-MYSCJDEHSA-N |
| XLogP | 2.11 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine?
The IUPAC name of (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine (CID 134313135) is (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine.
What is the SMILES notation for (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine?
The canonical SMILES for (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine is C=N/C(C)=C1/C=C(OC)C(OC)=C/C1=N\C.
What is the InChIKey of (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine?
The InChIKey is FCWKGUSRUKRGBB-MYSCJDEHSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-8(13-2)9-6-11(15-4)12(16-5)7-10(9)14-3/h6-7H,2H2,1,3-5H3/b9-8-,14-10+.
What are the key properties of (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine?
(6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine has a molecular weight of 220.27 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-3,4-dimethoxy-N-methyl-6-[1-(methylideneamino)ethylidene]cyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 134313135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).