C28H20F3N5O — CID 134313414
N-(5-phenyl-2-pyridinyl)-2-[5-phenyl-1-[2-(trifluoromethyl)phenyl]triazol-4-yl]acetamide (PubChem CID 134313414) has the molecular formula C28H20F3N5O and a molecular weight of 499.50 g/mol. Its IUPAC name is N-(5-phenyl-2-pyridinyl)-2-[5-phenyl-1-[2-(trifluoromethyl)phenyl]triazol-4-yl]acetamide.
| Compound Name | N-(5-phenyl-2-pyridinyl)-2-[5-phenyl-1-[2-(trifluoromethyl)phenyl]triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 134313414 |
| Molecular Formula | C28H20F3N5O |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-(5-phenyl-2-pyridinyl)-2-[5-phenyl-1-[2-(trifluoromethyl)phenyl]triazol-4-yl]acetamide |
| SMILES | O=C(Cc1nnn(-c2ccccc2C(F)(F)F)c1-c1ccccc1)Nc1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C28H20F3N5O/c29-28(30,31)22-13-7-8-14-24(22)36-27(20-11-5-2-6-12-20)23(34-35-36)17-26(37)33-25-16-15-21(18-32-25)19-9-3-1-4-10-19/h1-16,18H,17H2,(H,32,33,37) |
| InChIKey | BPNDNBVANMXNIA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |