C16H13F3N6 — CID 134313538
N-(1-amino-2,2,2-trifluoroethylidene)-8-benzylimidazo[1,2-a]pyrazine-6-carboximidamide (PubChem CID 134313538) has the molecular formula C16H13F3N6 and a molecular weight of 346.32 g/mol. Its IUPAC name is N-(1-amino-2,2,2-trifluoroethylidene)-8-benzylimidazo[1,2-a]pyrazine-6-carboximidamide.
| Compound Name | N-(1-amino-2,2,2-trifluoroethylidene)-8-benzylimidazo[1,2-a]pyrazine-6-carboximidamide |
|---|---|
| PubChem CID | 134313538 |
| Molecular Formula | C16H13F3N6 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-(1-amino-2,2,2-trifluoroethylidene)-8-benzylimidazo[1,2-a]pyrazine-6-carboximidamide |
| SMILES | [H]/N=C(\N=C(/N)C(F)(F)F)c1cn2ccnc2c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C16H13F3N6/c17-16(18,19)15(21)24-13(20)12-9-25-7-6-22-14(25)11(23-12)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H3,20,21,24) |
| InChIKey | NADWSGZFFJHZBI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|