C28H29NS — CID 134313593
(3E)-N-[(1E)-1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)thiophen-2-yl]buta-1,3-dienyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]hexa-1,3,5-trien-3-amine (PubChem CID 134313593) has the molecular formula C28H29NS and a molecular weight of 411.61 g/mol. Its IUPAC name is (3E)-N-[(1E)-1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)thiophen-2-yl]buta-1,3-dienyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]hexa-1,3,5-trien-3-amine.
| Compound Name | (3E)-N-[(1E)-1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)thiophen-2-yl]buta-1,3-dienyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]hexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 134313593 |
| Molecular Formula | C28H29NS |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (3E)-N-[(1E)-1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)thiophen-2-yl]buta-1,3-dienyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]hexa-1,3,5-trien-3-amine |
| SMILES | C=C/C=c1/c(C=C)c(/C(=C\C=C)N(/C(C=C)=C/C=C)/C(C=C)=C/C=C)s/c1=C/C=C |
| InChI | InChI=1S/C28H29NS/c1-9-17-22(14-6)29(23(15-7)18-10-2)26(20-12-4)28-24(16-8)25(19-11-3)27(30-28)21-13-5/h9-21H,1-8H2/b22-17+,23-18+,25-19-,26-20+,27-21+ |
| InChIKey | BALHTPRXFCMNKH-UPBJVCDWSA-N |
| XLogP | 6.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|