C30H31NS — CID 134313651
(3E,5Z)-N-[(1E)-1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)thiophen-2-yl]buta-1,3-dienyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-3-amine (PubChem CID 134313651) has the molecular formula C30H31NS and a molecular weight of 437.65 g/mol. Its IUPAC name is (3E,5Z)-N-[(1E)-1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)thiophen-2-yl]buta-1,3-dienyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-3-amine.
| Compound Name | (3E,5Z)-N-[(1E)-1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)thiophen-2-yl]buta-1,3-dienyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 134313651 |
| Molecular Formula | C30H31NS |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (3E,5Z)-N-[(1E)-1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)thiophen-2-yl]buta-1,3-dienyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-3-amine |
| SMILES | C=C/C=C\C=C(/C=C)N(/C(C=C)=C/C=C)/C(=C/C=C)c1sc(=C/C=C)/c(=C\C=C)c1C=C |
| InChI | InChI=1S/C30H31NS/c1-9-17-18-23-25(15-7)31(24(14-6)19-10-2)28(21-12-4)30-26(16-8)27(20-11-3)29(32-30)22-13-5/h9-23H,1-8H2/b18-17-,24-19+,25-23+,27-20-,28-21+,29-22+ |
| InChIKey | XZQDXWIBEZEQJH-PIRYREDDSA-N |
| XLogP | 7.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|