C13H11FN4O3 — CID 134313719
[(Z)-[[(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-methylamino]-(1,2,5-oxadiazol-3-yl)methylidene]amino] formate (PubChem CID 134313719) has the molecular formula C13H11FN4O3 and a molecular weight of 290.25 g/mol. Its IUPAC name is [(Z)-[[(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-methylamino]-(1,2,5-oxadiazol-3-yl)methylidene]amino] formate.
| Compound Name | [(Z)-[[(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-methylamino]-(1,2,5-oxadiazol-3-yl)methylidene]amino] formate |
|---|---|
| PubChem CID | 134313719 |
| Molecular Formula | C13H11FN4O3 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | [(Z)-[[(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-methylamino]-(1,2,5-oxadiazol-3-yl)methylidene]amino] formate |
| SMILES | CN(/C(=N\OC=O)c1cnon1)C1Cc2ccc(F)cc21 |
| InChI | InChI=1S/C13H11FN4O3/c1-18(12-4-8-2-3-9(14)5-10(8)12)13(17-20-7-19)11-6-15-21-16-11/h2-3,5-7,12H,4H2,1H3/b17-13- |
| InChIKey | MXUQYWAFTAYZBQ-LGMDPLHJSA-N |
| XLogP | 1.27 |
| TPSA | 80.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|