About 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole
5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole (PubChem CID 134313832) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole.
Molecular Properties
| Compound Name | 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole |
| PubChem CID | 134313832 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole |
| SMILES | CCCCCN1Cc2nc[nH]c2C1 |
| InChI | InChI=1S/C10H17N3/c1-2-3-4-5-13-6-9-10(7-13)12-8-11-9/h8H,2-7H2,1H3,(H,11,12) |
| InChIKey | FZYBVFDHQBSRRJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole?
The IUPAC name of 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole (CID 134313832) is 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole.
What is the SMILES notation for 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole?
The canonical SMILES for 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole is CCCCCN1Cc2nc[nH]c2C1.
What is the InChIKey of 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole?
The InChIKey is FZYBVFDHQBSRRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-2-3-4-5-13-6-9-10(7-13)12-8-11-9/h8H,2-7H2,1H3,(H,11,12).
What are the key properties of 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole?
5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole has a molecular weight of 179.27 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole is sourced from PubChem (CID 134313832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).