About [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene
[(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene (PubChem CID 134313943) has the molecular formula C19H38N2
and a molecular weight of 294.53 g/mol. Its IUPAC name is [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene.
Molecular Properties
| Compound Name | [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene |
| PubChem CID | 134313943 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene |
| SMILES | C/N=N/C(=C\CCCCCCCC(C)C)CCCC(C)C |
| InChI | InChI=1S/C19H38N2/c1-17(2)13-10-8-6-7-9-11-15-19(21-20-5)16-12-14-18(3)4/h15,17-18H,6-14,16H2,1-5H3/b19-15-,21-20+ |
| InChIKey | XOFJEHJYXDCCST-FCYXFUCKSA-N |
| XLogP | 7.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene?
The IUPAC name of [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene (CID 134313943) is [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene.
What is the SMILES notation for [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene?
The canonical SMILES for [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene is C/N=N/C(=C\CCCCCCCC(C)C)CCCC(C)C.
What is the InChIKey of [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene?
The InChIKey is XOFJEHJYXDCCST-FCYXFUCKSA-N. The full InChI is InChI=1S/C19H38N2/c1-17(2)13-10-8-6-7-9-11-15-19(21-20-5)16-12-14-18(3)4/h15,17-18H,6-14,16H2,1-5H3/b19-15-,21-20+.
What are the key properties of [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene?
[(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene has a molecular weight of 294.53 g/mol, XLogP of 7.17, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2,15-dimethylhexadec-6-en-6-yl]-methyldiazene is sourced from PubChem (CID 134313943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).