About [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene
[(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene (PubChem CID 134313946) has the molecular formula C18H36N2
and a molecular weight of 280.50 g/mol. Its IUPAC name is [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene.
Molecular Properties
| Compound Name | [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene |
| PubChem CID | 134313946 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene |
| SMILES | C/N=N/C(=C\CCCCCCC(C)C)CCCC(C)C |
| InChI | InChI=1S/C18H36N2/c1-16(2)12-9-7-6-8-10-14-18(20-19-5)15-11-13-17(3)4/h14,16-17H,6-13,15H2,1-5H3/b18-14-,20-19+ |
| InChIKey | SPAWYCMCSQLHKO-KLZMBSQASA-N |
| XLogP | 6.78 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene?
The IUPAC name of [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene (CID 134313946) is [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene.
What is the SMILES notation for [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene?
The canonical SMILES for [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene is C/N=N/C(=C\CCCCCCC(C)C)CCCC(C)C.
What is the InChIKey of [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene?
The InChIKey is SPAWYCMCSQLHKO-KLZMBSQASA-N. The full InChI is InChI=1S/C18H36N2/c1-16(2)12-9-7-6-8-10-14-18(20-19-5)15-11-13-17(3)4/h14,16-17H,6-13,15H2,1-5H3/b18-14-,20-19+.
What are the key properties of [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene?
[(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene has a molecular weight of 280.50 g/mol, XLogP of 6.78, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2,14-dimethylpentadec-6-en-6-yl]-methyldiazene is sourced from PubChem (CID 134313946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).