C7H8F6N2 — CID 134314199
(Z)-1,1,1,5,5,5-hexafluoro-N-methyl-4-methyliminopent-2-en-2-amine (PubChem CID 134314199) has the molecular formula C7H8F6N2 and a molecular weight of 234.14 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-N-methyl-4-methyliminopent-2-en-2-amine.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-N-methyl-4-methyliminopent-2-en-2-amine |
|---|---|
| PubChem CID | 134314199 |
| Molecular Formula | C7H8F6N2 |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-N-methyl-4-methyliminopent-2-en-2-amine |
| SMILES | C/N=C(/C=C(\NC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6N2/c1-14-4(6(8,9)10)3-5(15-2)7(11,12)13/h3,14H,1-2H3/b4-3-,15-5- |
| InChIKey | ANCXZVLWCUVKPT-GVLLYKPYSA-N |
| XLogP | 2.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|